C51H47N — CID 123782148
N-phenyl-4-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]-N-(1,1,2,3-tetramethylinden-5-yl)naphthalen-1-amine (PubChem CID 123782148) has the molecular formula C51H47N and a molecular weight of 673.94 g/mol. Its IUPAC name is N-phenyl-4-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]-N-(1,1,2,3-tetramethylinden-5-yl)naphthalen-1-amine.
| Compound Name | N-phenyl-4-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]-N-(1,1,2,3-tetramethylinden-5-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 123782148 |
| Molecular Formula | C51H47N |
| Molecular Weight | 673.94 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | N-phenyl-4-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]-N-(1,1,2,3-tetramethylinden-5-yl)naphthalen-1-amine |
| SMILES | CC1=C(C)C(C)(C)c2ccc(N(c3ccccc3)c3ccc(C=Cc4ccc5c(c4)C(C)(C)C4=C5C(C)(C)c5ccccc54)c4ccccc34)cc21 |
| InChI | InChI=1S/C51H47N/c1-32-33(2)49(3,4)44-28-26-37(31-42(32)44)52(36-16-10-9-11-17-36)46-29-25-35(38-18-12-13-19-39(38)46)24-22-34-23-27-41-45(30-34)51(7,8)47-40-20-14-15-21-43(40)50(5,6)48(41)47/h9-31H,1-8H3 |
| InChIKey | MQZJNXHUUJURCC-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.94 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|