C27H32N6O3 — CID 123782555
N-[1-[[6-[(E)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide (PubChem CID 123782555) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[1-[[6-[(E)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide.
| Compound Name | N-[1-[[6-[(E)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 123782555 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-[1-[[6-[(E)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NC1CCc2ccccc2N(Cc2c(OC)ccc3cc(/C(N)=N\N)ccc23)C1=O |
| InChI | InChI=1S/C27H32N6O3/c1-16(30-2)26(34)31-22-12-9-17-6-4-5-7-23(17)33(27(22)35)15-21-20-11-8-19(25(28)32-29)14-18(20)10-13-24(21)36-3/h4-8,10-11,13-14,16,22,30H,9,12,15,29H2,1-3H3,(H2,28,32)(H,31,34) |
| InChIKey | ZRXGQVDJIIYRDL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|