C27H32N6O3 — CID 140780713
2-[(3S)-1-[[6-[(Z)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide (PubChem CID 140780713) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[(3S)-1-[[6-[(Z)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide.
| Compound Name | 2-[(3S)-1-[[6-[(Z)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 140780713 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-[(3S)-1-[[6-[(Z)-C-aminocarbonohydrazonoyl]-2-methoxynaphthalen-1-yl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-2-(methylamino)propanamide |
| SMILES | CNC(C)(C(N)=O)[C@@H]1CCc2ccccc2N(Cc2c(OC)ccc3cc(/C(N)=N/N)ccc23)C1=O |
| InChI | InChI=1S/C27H32N6O3/c1-27(31-2,26(29)35)21-12-9-16-6-4-5-7-22(16)33(25(21)34)15-20-19-11-8-18(24(28)32-30)14-17(19)10-13-23(20)36-3/h4-8,10-11,13-14,21,31H,9,12,15,30H2,1-3H3,(H2,28,32)(H2,29,35)/t21-,27?/m1/s1 |
| InChIKey | DKQUUMQNJZSTGH-XJQHNOHDSA-N |
| XLogP | 1.99 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|