C23H21N5OS — CID 123783365
4-[4-[2-(2-iminopropoxy)-4-pyridinyl]phenyl]-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 123783365) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-[4-[2-(2-iminopropoxy)-4-pyridinyl]phenyl]-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[4-[2-(2-iminopropoxy)-4-pyridinyl]phenyl]-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123783365 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 4-[4-[2-(2-iminopropoxy)-4-pyridinyl]phenyl]-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | [H]/N=C(\C)COc1cc(-c2ccc(-c3csc(Nc4cccc(C)n4)n3)cc2)ccn1 |
| InChI | InChI=1S/C23H21N5OS/c1-15(24)13-29-22-12-19(10-11-25-22)17-6-8-18(9-7-17)20-14-30-23(27-20)28-21-5-3-4-16(2)26-21/h3-12,14,24H,13H2,1-2H3,(H,26,27,28)/b24-15+ |
| InChIKey | LLJOHKADTIASCF-BUVRLJJBSA-N |
| XLogP | 5.74 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|