C19H18N2O — CID 123784007
1-ethylidene-2-propylidene-[1]benzofuro[3,2-e]indol-3-amine (PubChem CID 123784007) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-ethylidene-2-propylidene-[1]benzofuro[3,2-e]indol-3-amine.
| Compound Name | 1-ethylidene-2-propylidene-[1]benzofuro[3,2-e]indol-3-amine |
|---|---|
| PubChem CID | 123784007 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-ethylidene-2-propylidene-[1]benzofuro[3,2-e]indol-3-amine |
| SMILES | CC=c1c(=CCC)n(N)c2ccc3oc4ccccc4c3c12 |
| InChI | InChI=1S/C19H18N2O/c1-3-7-14-12(4-2)18-15(21(14)20)10-11-17-19(18)13-8-5-6-9-16(13)22-17/h4-11H,3,20H2,1-2H3 |
| InChIKey | CCZOXBKJRMFCBZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |