C16H25N3 — CID 123784128
4-hex-1-en-2-yl-3-hex-4-en-2-ylidenepyrazin-2-amine (PubChem CID 123784128) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 4-hex-1-en-2-yl-3-hex-4-en-2-ylidenepyrazin-2-amine.
| Compound Name | 4-hex-1-en-2-yl-3-hex-4-en-2-ylidenepyrazin-2-amine |
|---|---|
| PubChem CID | 123784128 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 4-hex-1-en-2-yl-3-hex-4-en-2-ylidenepyrazin-2-amine |
| SMILES | C=C(CCCC)N1C=CN=C(N)C1=C(C)CC=CC |
| InChI | InChI=1S/C16H25N3/c1-5-7-9-13(3)15-16(17)18-11-12-19(15)14(4)10-8-6-2/h5,7,11-12H,4,6,8-10H2,1-3H3,(H2,17,18) |
| InChIKey | LQLBXJPREQQQPE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|