C19H29N3 — CID 123787402
3-(3-methylidenehex-4-en-2-ylidene)-4-oct-2-en-3-ylpyrazin-2-amine (PubChem CID 123787402) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-(3-methylidenehex-4-en-2-ylidene)-4-oct-2-en-3-ylpyrazin-2-amine.
| Compound Name | 3-(3-methylidenehex-4-en-2-ylidene)-4-oct-2-en-3-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 123787402 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 3-(3-methylidenehex-4-en-2-ylidene)-4-oct-2-en-3-ylpyrazin-2-amine |
| SMILES | C=C(C=CC)C(C)=C1C(N)=NC=CN1C(=CC)CCCCC |
| InChI | InChI=1S/C19H29N3/c1-6-9-10-12-17(8-3)22-14-13-21-19(20)18(22)16(5)15(4)11-7-2/h7-8,11,13-14H,4,6,9-10,12H2,1-3,5H3,(H2,20,21) |
| InChIKey | QLYXXHGRPPOPPL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|