C29H22ClF4N3O3 — CID 123785533
1-[2-(3-acetylindol-1-yl)acetyl]-N-[3-(2-chloro-3,4-difluorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 123785533) has the molecular formula C29H22ClF4N3O3 and a molecular weight of 571.96 g/mol. Its IUPAC name is 1-[2-(3-acetylindol-1-yl)acetyl]-N-[3-(2-chloro-3,4-difluorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(3-acetylindol-1-yl)acetyl]-N-[3-(2-chloro-3,4-difluorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123785533 |
| Molecular Formula | C29H22ClF4N3O3 |
| Molecular Weight | 571.96 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 1-[2-(3-acetylindol-1-yl)acetyl]-N-[3-(2-chloro-3,4-difluorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CC(=O)c1cn(CC(=O)N2CC(F)CC2C(=O)Nc2cccc(-c3ccc(F)c(F)c3Cl)c2F)c2ccccc12 |
| InChI | InChI=1S/C29H22ClF4N3O3/c1-15(38)20-13-36(23-8-3-2-5-17(20)23)14-25(39)37-12-16(31)11-24(37)29(40)35-22-7-4-6-19(27(22)33)18-9-10-21(32)28(34)26(18)30/h2-10,13,16,24H,11-12,14H2,1H3,(H,35,40) |
| InChIKey | MYFVAOKXGLCURE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.96 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|