C19H19BClN4O — CID 123785841
CID 123785841 (PubChem CID 123785841) has the molecular formula C19H19BClN4O and a molecular weight of 365.65 g/mol.
| Compound Name | CID 123785841 |
|---|---|
| PubChem CID | 123785841 |
| Molecular Formula | C19H19BClN4O |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | — |
| SMILES | C=C[B]C(C)(C(=O)NCC)c1ccnc2c(-c3ccc(Cl)cc3)cnn12 |
| InChI | InChI=1S/C19H19BClN4O/c1-4-20-19(3,18(26)22-5-2)16-10-11-23-17-15(12-24-25(16)17)13-6-8-14(21)9-7-13/h4,6-12H,1,5H2,2-3H3,(H,22,26) |
| InChIKey | URYFJRIWNQMZFH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|