C17H38N2Si — CID 123785851
N,N'-dibutyl-1-ethenylsilyl-N,N'-dipropylmethanediamine (PubChem CID 123785851) has the molecular formula C17H38N2Si and a molecular weight of 298.59 g/mol. Its IUPAC name is N,N'-dibutyl-1-ethenylsilyl-N,N'-dipropylmethanediamine.
| Compound Name | N,N'-dibutyl-1-ethenylsilyl-N,N'-dipropylmethanediamine |
|---|---|
| PubChem CID | 123785851 |
| Molecular Formula | C17H38N2Si |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 298.28 |
| IUPAC Name | N,N'-dibutyl-1-ethenylsilyl-N,N'-dipropylmethanediamine |
| SMILES | C=C[SiH2]C(N(CCC)CCCC)N(CCC)CCCC |
| InChI | InChI=1S/C17H38N2Si/c1-6-11-15-18(13-8-3)17(20-10-5)19(14-9-4)16-12-7-2/h10,17H,5-9,11-16,20H2,1-4H3 |
| InChIKey | WNNJBGHVLUZKHI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|