C16H25NO6 — CID 123786050
carbon dioxide;(E)-N-[2-[2-[(Z)-2-oxohept-4-enoxy]ethoxy]ethyl]but-2-enamide (PubChem CID 123786050) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is carbon dioxide;(E)-N-[2-[2-[(Z)-2-oxohept-4-enoxy]ethoxy]ethyl]but-2-enamide.
| Compound Name | carbon dioxide;(E)-N-[2-[2-[(Z)-2-oxohept-4-enoxy]ethoxy]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 123786050 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | carbon dioxide;(E)-N-[2-[2-[(Z)-2-oxohept-4-enoxy]ethoxy]ethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCOCCOCC(=O)C/C=C\CC.O=C=O |
| InChI | InChI=1S/C15H25NO4.CO2/c1-3-5-6-8-14(17)13-20-12-11-19-10-9-16-15(18)7-4-2;2-1-3/h4-7H,3,8-13H2,1-2H3,(H,16,18);/b6-5-,7-4+; |
| InChIKey | YUVKLRUCAMVNHE-BIFKCLKRSA-N |
| XLogP | 1.05 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|