C19H35NO6 — CID 167420658
(E)-5-methyl-N-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-oxohex-2-enamide (PubChem CID 167420658) has the molecular formula C19H35NO6 and a molecular weight of 373.49 g/mol. Its IUPAC name is (E)-5-methyl-N-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-oxohex-2-enamide.
| Compound Name | (E)-5-methyl-N-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 167420658 |
| Molecular Formula | C19H35NO6 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | (E)-5-methyl-N-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-oxohex-2-enamide |
| SMILES | CC(C)COCCOCCOCCOCCNC(=O)/C=C/C(=O)C(C)C |
| InChI | InChI=1S/C19H35NO6/c1-16(2)15-26-14-13-25-12-11-24-10-9-23-8-7-20-19(22)6-5-18(21)17(3)4/h5-6,16-17H,7-15H2,1-4H3,(H,20,22)/b6-5+ |
| InChIKey | NIMDCKCURXMHBS-AATRIKPKSA-N |
| XLogP | 1.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|