C20H38NO4Sb — CID 145018895
N-(2-methoxyethyl)-4-[methyl(propyl)stibanyl]butanamide;(Z)-6-methyloct-3-ene-2,5-dione (PubChem CID 145018895) has the molecular formula C20H38NO4Sb and a molecular weight of 478.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[methyl(propyl)stibanyl]butanamide;(Z)-6-methyloct-3-ene-2,5-dione.
| Compound Name | N-(2-methoxyethyl)-4-[methyl(propyl)stibanyl]butanamide;(Z)-6-methyloct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 145018895 |
| Molecular Formula | C20H38NO4Sb |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-[methyl(propyl)stibanyl]butanamide;(Z)-6-methyloct-3-ene-2,5-dione |
| SMILES | CCC(C)C(=O)/C=C\C(C)=O.CCC[Sb](C)CCCC(=O)NCCOC |
| InChI | InChI=1S/C9H14O2.C7H14NO2.C3H7.CH3.Sb/c1-4-7(2)9(11)6-5-8(3)10;1-3-4-7(9)8-5-6-10-2;1-3-2;;/h5-7H,4H2,1-3H3;1,3-6H2,2H3,(H,8,9);1,3H2,2H3;1H3;/b6-5-;;;; |
| InChIKey | RSVOGRDMSYQDBI-YGGCHVFLSA-N |
| XLogP | 3.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|