C40H59B2N5O3 — CID 123786359
N-[[9-[2-[4-(1-ethylpyrazol-4-yl)phenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-2,6-dimethylnonan-2-yl]oxy-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]boranyl]methanamine (PubChem CID 123786359) has the molecular formula C40H59B2N5O3 and a molecular weight of 679.57 g/mol. Its IUPAC name is N-[[9-[2-[4-(1-ethylpyrazol-4-yl)phenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-2,6-dimethylnonan-2-yl]oxy-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]boranyl]methanamine.
| Compound Name | N-[[9-[2-[4-(1-ethylpyrazol-4-yl)phenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-2,6-dimethylnonan-2-yl]oxy-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]boranyl]methanamine |
|---|---|
| PubChem CID | 123786359 |
| Molecular Formula | C40H59B2N5O3 |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 679.48 |
| IUPAC Name | N-[[9-[2-[4-(1-ethylpyrazol-4-yl)phenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-2,6-dimethylnonan-2-yl]oxy-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]boranyl]methanamine |
| SMILES | CCn1cc(-c2ccc(B3OC(C)(C)C(C)(CCCC(C)CCCC(C)(C)OB(NC)c4ccc(-c5cnn(C(C)C)c5)cc4)O3)cc2)cn1 |
| InChI | InChI=1S/C40H59B2N5O3/c1-11-46-28-34(26-44-46)32-18-22-37(23-19-32)42-49-39(7,8)40(9,50-42)25-13-15-31(4)14-12-24-38(5,6)48-41(43-10)36-20-16-33(17-21-36)35-27-45-47(29-35)30(2)3/h16-23,26-31,43H,11-15,24-25H2,1-10H3 |
| InChIKey | KJCUKBQUIDEROY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|