C41H58B2N4O4 — CID 144611858
1-ethyl-4-[4-[4,4,5-trimethyl-5-[4-methyl-7-[4,5,5-trimethyl-2-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]-1,3,2-dioxaborolan-4-yl]heptyl]-1,3,2-dioxaborolan-2-yl]phenyl]pyrazole (PubChem CID 144611858) has the molecular formula C41H58B2N4O4 and a molecular weight of 692.56 g/mol. Its IUPAC name is 1-ethyl-4-[4-[4,4,5-trimethyl-5-[4-methyl-7-[4,5,5-trimethyl-2-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]-1,3,2-dioxaborolan-4-yl]heptyl]-1,3,2-dioxaborolan-2-yl]phenyl]pyrazole.
| Compound Name | 1-ethyl-4-[4-[4,4,5-trimethyl-5-[4-methyl-7-[4,5,5-trimethyl-2-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]-1,3,2-dioxaborolan-4-yl]heptyl]-1,3,2-dioxaborolan-2-yl]phenyl]pyrazole |
|---|---|
| PubChem CID | 144611858 |
| Molecular Formula | C41H58B2N4O4 |
| Molecular Weight | 692.56 g/mol |
| Exact Mass | 692.46 |
| IUPAC Name | 1-ethyl-4-[4-[4,4,5-trimethyl-5-[4-methyl-7-[4,5,5-trimethyl-2-[4-(1-propan-2-ylpyrazol-4-yl)phenyl]-1,3,2-dioxaborolan-4-yl]heptyl]-1,3,2-dioxaborolan-2-yl]phenyl]pyrazole |
| SMILES | CCn1cc(-c2ccc(B3OC(C)(C)C(C)(CCCC(C)CCCC4(C)OB(c5ccc(-c6cnn(C(C)C)c6)cc5)OC4(C)C)O3)cc2)cn1 |
| InChI | InChI=1S/C41H58B2N4O4/c1-11-46-28-34(26-44-46)32-16-20-36(21-17-32)42-48-38(5,6)40(9,50-42)24-12-14-31(4)15-13-25-41(10)39(7,8)49-43(51-41)37-22-18-33(19-23-37)35-27-45-47(29-35)30(2)3/h16-23,26-31H,11-15,24-25H2,1-10H3 |
| InChIKey | AVTAXXXOSPQNBW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.56 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|