C15H19Cl2NO3 — CID 123789560
3-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]azetidine-1-carboxylic acid (PubChem CID 123789560) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 3-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]azetidine-1-carboxylic acid.
| Compound Name | 3-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123789560 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]azetidine-1-carboxylic acid |
| SMILES | CCOc1c(C(C)Cl)cc(Cl)c(C)c1C1CN(C(=O)O)C1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-4-21-14-11(9(3)16)5-12(17)8(2)13(14)10-6-18(7-10)15(19)20/h5,9-10H,4,6-7H2,1-3H3,(H,19,20) |
| InChIKey | LSCZDHSHWLVIRW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|