C17H22Cl3NO3 — CID 86677811
tert-butyl 3-[2,3-dichloro-5-(1-chloroethyl)-6-methoxyphenyl]azetidine-1-carboxylate (PubChem CID 86677811) has the molecular formula C17H22Cl3NO3 and a molecular weight of 394.73 g/mol. Its IUPAC name is tert-butyl 3-[2,3-dichloro-5-(1-chloroethyl)-6-methoxyphenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2,3-dichloro-5-(1-chloroethyl)-6-methoxyphenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 86677811 |
| Molecular Formula | C17H22Cl3NO3 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | tert-butyl 3-[2,3-dichloro-5-(1-chloroethyl)-6-methoxyphenyl]azetidine-1-carboxylate |
| SMILES | COc1c(C(C)Cl)cc(Cl)c(Cl)c1C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H22Cl3NO3/c1-9(18)11-6-12(19)14(20)13(15(11)23-5)10-7-21(8-10)16(22)24-17(2,3)4/h6,9-10H,7-8H2,1-5H3 |
| InChIKey | FHYWJESBKROZJL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|