C17H21Cl2NO4Zn — CID 161425917
tert-butyl 3-(5-acetyl-2,3-dichloro-6-methoxyphenyl)azetidine-1-carboxylate;zinc (PubChem CID 161425917) has the molecular formula C17H21Cl2NO4Zn and a molecular weight of 439.65 g/mol. Its IUPAC name is tert-butyl 3-(5-acetyl-2,3-dichloro-6-methoxyphenyl)azetidine-1-carboxylate;zinc.
| Compound Name | tert-butyl 3-(5-acetyl-2,3-dichloro-6-methoxyphenyl)azetidine-1-carboxylate;zinc |
|---|---|
| PubChem CID | 161425917 |
| Molecular Formula | C17H21Cl2NO4Zn |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | tert-butyl 3-(5-acetyl-2,3-dichloro-6-methoxyphenyl)azetidine-1-carboxylate;zinc |
| SMILES | COc1c(C(C)=O)cc(Cl)c(Cl)c1C1CN(C(=O)OC(C)(C)C)C1.[Zn] |
| InChI | InChI=1S/C17H21Cl2NO4.Zn/c1-9(21)11-6-12(18)14(19)13(15(11)23-5)10-7-20(8-10)16(22)24-17(2,3)4;/h6,10H,7-8H2,1-5H3; |
| InChIKey | VXIXFQCFAZJKHY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|