C12H13Cl2NO2 — CID 89422199
1-[3-(azetidin-3-yl)-4,5-dichloro-2-methoxyphenyl]ethanone (PubChem CID 89422199) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 1-[3-(azetidin-3-yl)-4,5-dichloro-2-methoxyphenyl]ethanone.
| Compound Name | 1-[3-(azetidin-3-yl)-4,5-dichloro-2-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 89422199 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 1-[3-(azetidin-3-yl)-4,5-dichloro-2-methoxyphenyl]ethanone |
| SMILES | COc1c(C(C)=O)cc(Cl)c(Cl)c1C1CNC1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-6(16)8-3-9(13)11(14)10(12(8)17-2)7-4-15-5-7/h3,7,15H,4-5H2,1-2H3 |
| InChIKey | PKVABINHODXEPW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |