C15H20ClNO4 — CID 96709317
(5-chloro-2,3,4-trimethoxyphenyl)-piperidin-4-ylmethanone (PubChem CID 96709317) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is (5-chloro-2,3,4-trimethoxyphenyl)-piperidin-4-ylmethanone.
| Compound Name | (5-chloro-2,3,4-trimethoxyphenyl)-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 96709317 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (5-chloro-2,3,4-trimethoxyphenyl)-piperidin-4-ylmethanone |
| SMILES | COc1c(Cl)cc(C(=O)C2CCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C15H20ClNO4/c1-19-13-10(12(18)9-4-6-17-7-5-9)8-11(16)14(20-2)15(13)21-3/h8-9,17H,4-7H2,1-3H3 |
| InChIKey | XHVQHJVLNGNNPO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |