About 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol
3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol (PubChem CID 123789565) has the molecular formula C14H31NO2
and a molecular weight of 245.41 g/mol. Its IUPAC name is 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol.
Molecular Properties
| Compound Name | 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol |
| PubChem CID | 123789565 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol |
| SMILES | CNC(C)C(O)COC(C)(C)C(C)CC(C)C |
| InChI | InChI=1S/C14H31NO2/c1-10(2)8-11(3)14(5,6)17-9-13(16)12(4)15-7/h10-13,15-16H,8-9H2,1-7H3 |
| InChIKey | AWFXPVUTHWQSRL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol?
The IUPAC name of 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol (CID 123789565) is 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol.
What is the SMILES notation for 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol?
The canonical SMILES for 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol is CNC(C)C(O)COC(C)(C)C(C)CC(C)C.
What is the InChIKey of 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol?
The InChIKey is AWFXPVUTHWQSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO2/c1-10(2)8-11(3)14(5,6)17-9-13(16)12(4)15-7/h10-13,15-16H,8-9H2,1-7H3.
What are the key properties of 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol?
3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol has a molecular weight of 245.41 g/mol, XLogP of 2.43, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol is sourced from PubChem (CID 123789565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).