C14H31NO2 — CID 123789565
3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol (PubChem CID 123789565) has the molecular formula C14H31NO2 and a molecular weight of 245.41 g/mol. Its IUPAC name is 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol.
| Compound Name | 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol |
|---|---|
| PubChem CID | 123789565 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 3-(methylamino)-1-(2,3,5-trimethylhexan-2-yloxy)butan-2-ol |
| SMILES | CNC(C)C(O)COC(C)(C)C(C)CC(C)C |
| InChI | InChI=1S/C14H31NO2/c1-10(2)8-11(3)14(5,6)17-9-13(16)12(4)15-7/h10-13,15-16H,8-9H2,1-7H3 |
| InChIKey | AWFXPVUTHWQSRL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |