C28H36O6 — CID 123790074
[2-(16-acetyloxy-7-hydroxy-6,8,19-trimethyl-7-pentacyclo[9.8.0.01,4.06,10.014,19]nonadeca-13,15,17-trienyl)-2-oxoethyl] acetate (PubChem CID 123790074) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is [2-(16-acetyloxy-7-hydroxy-6,8,19-trimethyl-7-pentacyclo[9.8.0.01,4.06,10.014,19]nonadeca-13,15,17-trienyl)-2-oxoethyl] acetate.
| Compound Name | [2-(16-acetyloxy-7-hydroxy-6,8,19-trimethyl-7-pentacyclo[9.8.0.01,4.06,10.014,19]nonadeca-13,15,17-trienyl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 123790074 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [2-(16-acetyloxy-7-hydroxy-6,8,19-trimethyl-7-pentacyclo[9.8.0.01,4.06,10.014,19]nonadeca-13,15,17-trienyl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1(O)C(C)CC2C3CC=C4C=C(OC(C)=O)C=CC4(C)C34CCC4CC21C |
| InChI | InChI=1S/C28H36O6/c1-16-12-23-22-7-6-19-13-21(34-18(3)30)9-10-25(19,4)27(22)11-8-20(27)14-26(23,5)28(16,32)24(31)15-33-17(2)29/h6,9-10,13,16,20,22-23,32H,7-8,11-12,14-15H2,1-5H3 |
| InChIKey | IYBNQHYNWURNEA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |