C26H32O6 — CID 88760813
[2-[(1R,2S,10S,11S,14S,15S)-5-acetyloxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,5,7-trien-14-yl]-2-oxoethyl] acetate (PubChem CID 88760813) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [2-[(1R,2S,10S,11S,14S,15S)-5-acetyloxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,5,7-trien-14-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1R,2S,10S,11S,14S,15S)-5-acetyloxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,5,7-trien-14-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 88760813 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [2-[(1R,2S,10S,11S,14S,15S)-5-acetyloxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,5,7-trien-14-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1C(C)C[C@H]2[C@@H]3CC=C4C=C(OC(C)=O)C=C[C@]4(C)[C@]34OC4C[C@]12C |
| InChI | InChI=1S/C26H32O6/c1-14-10-20-19-7-6-17-11-18(31-16(3)28)8-9-25(17,5)26(19)22(32-26)12-24(20,4)23(14)21(29)13-30-15(2)27/h6,8-9,11,14,19-20,22-23H,7,10,12-13H2,1-5H3/t14?,19-,20-,22?,23+,24-,25-,26-/m0/s1 |
| InChIKey | OLGJYJMCXXXRKC-XCYGICQOSA-N |
| XLogP | 3.91 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|