C27H34O8 — CID 57013025
[2-[(1R,2S,10S,11S,14R,15S)-5,14-diacetyloxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-dien-14-yl]-2-oxoethyl] acetate (PubChem CID 57013025) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is [2-[(1R,2S,10S,11S,14R,15S)-5,14-diacetyloxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-dien-14-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1R,2S,10S,11S,14R,15S)-5,14-diacetyloxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-dien-14-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 57013025 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [2-[(1R,2S,10S,11S,14R,15S)-5,14-diacetyloxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-dien-14-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(C)=O)CC[C@H]2[C@@H]3CC=C4C=C(OC(C)=O)CC[C@]4(C)[C@]34OC4C[C@@]21C |
| InChI | InChI=1S/C27H34O8/c1-15(28)32-14-22(31)26(34-17(3)30)11-9-20-21-7-6-18-12-19(33-16(2)29)8-10-24(18,4)27(21)23(35-27)13-25(20,26)5/h6,12,20-21,23H,7-11,13-14H2,1-5H3/t20-,21-,23?,24-,25-,26-,27-/m0/s1 |
| InChIKey | RKOWNQZXTGIVCE-HSFCOPNBSA-N |
| XLogP | 3.57 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|