C11H19N3 — CID 123790750
(4Z)-6-piperazin-1-ylhepta-4,6-dien-3-imine (PubChem CID 123790750) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (4Z)-6-piperazin-1-ylhepta-4,6-dien-3-imine.
| Compound Name | (4Z)-6-piperazin-1-ylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 123790750 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (4Z)-6-piperazin-1-ylhepta-4,6-dien-3-imine |
| SMILES | [H]/N=C(/C=C\C(=C)N1CCNCC1)CC |
| InChI | InChI=1S/C11H19N3/c1-3-11(12)5-4-10(2)14-8-6-13-7-9-14/h4-5,12-13H,2-3,6-9H2,1H3/b5-4-,12-11+ |
| InChIKey | VJIYPVGLMARONV-LKYDAOQMSA-N |
| XLogP | 1.39 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|