C11H20N2 — CID 123513416
1-hepta-2,4-dien-4-ylpiperazine (PubChem CID 123513416) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-hepta-2,4-dien-4-ylpiperazine.
| Compound Name | 1-hepta-2,4-dien-4-ylpiperazine |
|---|---|
| PubChem CID | 123513416 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-hepta-2,4-dien-4-ylpiperazine |
| SMILES | CC=CC(=CCC)N1CCNCC1 |
| InChI | InChI=1S/C11H20N2/c1-3-5-11(6-4-2)13-9-7-12-8-10-13/h3,5-6,12H,4,7-10H2,1-2H3 |
| InChIKey | BYUFPOQIEQDVLE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|