C11H19FN2 — CID 123503621
1-(2-fluorohexa-1,3-dien-3-yl)-3-methylpiperazine (PubChem CID 123503621) has the molecular formula C11H19FN2 and a molecular weight of 198.28 g/mol. Its IUPAC name is 1-(2-fluorohexa-1,3-dien-3-yl)-3-methylpiperazine.
| Compound Name | 1-(2-fluorohexa-1,3-dien-3-yl)-3-methylpiperazine |
|---|---|
| PubChem CID | 123503621 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-(2-fluorohexa-1,3-dien-3-yl)-3-methylpiperazine |
| SMILES | C=C(F)C(=CCC)N1CCNC(C)C1 |
| InChI | InChI=1S/C11H19FN2/c1-4-5-11(10(3)12)14-7-6-13-9(2)8-14/h5,9,13H,3-4,6-8H2,1-2H3 |
| InChIKey | NDWCMPBANLRFLO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|