C10H17FN2 — CID 123849712
1-(4-fluorohexa-2,4-dien-3-yl)piperazine (PubChem CID 123849712) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is 1-(4-fluorohexa-2,4-dien-3-yl)piperazine.
| Compound Name | 1-(4-fluorohexa-2,4-dien-3-yl)piperazine |
|---|---|
| PubChem CID | 123849712 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 1-(4-fluorohexa-2,4-dien-3-yl)piperazine |
| SMILES | CC=C(F)C(=CC)N1CCNCC1 |
| InChI | InChI=1S/C10H17FN2/c1-3-9(11)10(4-2)13-7-5-12-6-8-13/h3-4,12H,5-8H2,1-2H3 |
| InChIKey | OPMBBPZAWKAZRI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|