C8H13FN2 — CID 123812074
1-(3-fluorobuta-1,3-dien-2-yl)piperazine (PubChem CID 123812074) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is 1-(3-fluorobuta-1,3-dien-2-yl)piperazine.
| Compound Name | 1-(3-fluorobuta-1,3-dien-2-yl)piperazine |
|---|---|
| PubChem CID | 123812074 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 1-(3-fluorobuta-1,3-dien-2-yl)piperazine |
| SMILES | C=C(F)C(=C)N1CCNCC1 |
| InChI | InChI=1S/C8H13FN2/c1-7(9)8(2)11-5-3-10-4-6-11/h10H,1-6H2 |
| InChIKey | VGVJCUIZFMBXSX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|