C9H15FN2 — CID 176931848
1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]piperazine (PubChem CID 176931848) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is 1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]piperazine.
| Compound Name | 1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]piperazine |
|---|---|
| PubChem CID | 176931848 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]piperazine |
| SMILES | C=C/C(=C(\C)F)N1CCNCC1 |
| InChI | InChI=1S/C9H15FN2/c1-3-9(8(2)10)12-6-4-11-5-7-12/h3,11H,1,4-7H2,2H3/b9-8- |
| InChIKey | GDFNFYMBLNSPEI-HJWRWDBZSA-N |
| XLogP | 1.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|