C11H19FN2 — CID 143191827
N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 143191827) has the molecular formula C11H19FN2 and a molecular weight of 198.28 g/mol. Its IUPAC name is N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143191827 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C(F)/C=C\C(=C/C)N(C)CCNC |
| InChI | InChI=1S/C11H19FN2/c1-5-11(7-6-10(2)12)14(4)9-8-13-3/h5-7,13H,2,8-9H2,1,3-4H3/b7-6-,11-5+ |
| InChIKey | QNOYCIRYPFKSPZ-TUKAJDRUSA-N |
| XLogP | 2.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|