C10H20FN2P — CID 142440482
N'-[(2Z,4Z)-3-fluoro-1-phosphanylhexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 142440482) has the molecular formula C10H20FN2P and a molecular weight of 218.26 g/mol. Its IUPAC name is N'-[(2Z,4Z)-3-fluoro-1-phosphanylhexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(2Z,4Z)-3-fluoro-1-phosphanylhexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142440482 |
| Molecular Formula | C10H20FN2P |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N'-[(2Z,4Z)-3-fluoro-1-phosphanylhexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C/C=C\C(F)=C(/CP)N(C)CCNC |
| InChI | InChI=1S/C10H20FN2P/c1-4-5-9(11)10(8-14)13(3)7-6-12-2/h4-5,12H,6-8,14H2,1-3H3/b5-4-,10-9- |
| InChIKey | AZPLHDQWPNABNM-ACHWKMRWSA-N |
| XLogP | 1.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|