C12H21FN2 — CID 142272191
N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine (PubChem CID 142272191) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142272191 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C(/C)F)N(CC)CCNC |
| InChI | InChI=1S/C12H21FN2/c1-5-7-8-12(11(3)13)15(6-2)10-9-14-4/h5,7-8,14H,1,6,9-10H2,2-4H3/b8-7-,12-11- |
| InChIKey | BMQZDLFTTINPTD-MQEUWQHPSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|