C10H15FN2 — CID 142067409
1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]piperazine (PubChem CID 142067409) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]piperazine.
| Compound Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 142067409 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]piperazine |
| SMILES | C=C(F)/C=C\C(=C)N1CCNCC1 |
| InChI | InChI=1S/C10H15FN2/c1-9(11)3-4-10(2)13-7-5-12-6-8-13/h3-4,12H,1-2,5-8H2/b4-3- |
| InChIKey | KSVVOGCSYIKINC-ARJAWSKDSA-N |
| XLogP | 1.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|