C11H17FN2 — CID 143054402
1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methylpiperazine (PubChem CID 143054402) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methylpiperazine.
| Compound Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 143054402 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methylpiperazine |
| SMILES | C=C(F)/C=C\C(=C)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H17FN2/c1-10(12)4-5-11(2)14-8-6-13(3)7-9-14/h4-5H,1-2,6-9H2,3H3/b5-4- |
| InChIKey | MPAWDLMJQOKZKL-PLNGDYQASA-N |
| XLogP | 1.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|