C11H19FN2 — CID 129212975
(2S)-1-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-2-methylpiperazine (PubChem CID 129212975) has the molecular formula C11H19FN2 and a molecular weight of 198.29 g/mol. Its IUPAC name is (2S)-1-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-2-methylpiperazine.
| Compound Name | (2S)-1-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-2-methylpiperazine |
|---|---|
| PubChem CID | 129212975 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (2S)-1-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-2-methylpiperazine |
| SMILES | C/C(F)=C\C=C(/C)N1CCNC[C@@H]1C |
| InChI | InChI=1S/C11H19FN2/c1-9(12)4-5-10(2)14-7-6-13-8-11(14)3/h4-5,11,13H,6-8H2,1-3H3/b9-4+,10-5+/t11-/m0/s1 |
| InChIKey | LLNZFVCFEMKIER-MHMWWSKESA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|