C13H21FN2 — CID 142262364
(3S)-1-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4,6-trienyl]-3-methylpiperazine (PubChem CID 142262364) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is (3S)-1-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4,6-trienyl]-3-methylpiperazine.
| Compound Name | (3S)-1-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4,6-trienyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 142262364 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | (3S)-1-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4,6-trienyl]-3-methylpiperazine |
| SMILES | C=C/C=C\C(F)=C(/C)CN1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C13H21FN2/c1-4-5-6-13(14)11(2)9-16-8-7-15-12(3)10-16/h4-6,12,15H,1,7-10H2,2-3H3/b6-5-,13-11-/t12-/m0/s1 |
| InChIKey | SWSHYYHFKLWDIH-UAKQXJPQSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|