C10H16FN3 — CID 143054123
(3E)-4-fluoro-5-piperazin-1-ylhexa-1,3,5-trien-2-amine (PubChem CID 143054123) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is (3E)-4-fluoro-5-piperazin-1-ylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-fluoro-5-piperazin-1-ylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143054123 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | (3E)-4-fluoro-5-piperazin-1-ylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(/F)C(=C)N1CCNCC1 |
| InChI | InChI=1S/C10H16FN3/c1-8(12)7-10(11)9(2)14-5-3-13-4-6-14/h7,13H,1-6,12H2/b10-7+ |
| InChIKey | FIGUKCVEAOZIAD-JXMROGBWSA-N |
| XLogP | 0.73 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|