C8H13FN2 — CID 126734944
(3E,5E)-5-fluoro-2-N-methylhepta-1,3,5-triene-2,3-diamine (PubChem CID 126734944) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is (3E,5E)-5-fluoro-2-N-methylhepta-1,3,5-triene-2,3-diamine.
| Compound Name | (3E,5E)-5-fluoro-2-N-methylhepta-1,3,5-triene-2,3-diamine |
|---|---|
| PubChem CID | 126734944 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | (3E,5E)-5-fluoro-2-N-methylhepta-1,3,5-triene-2,3-diamine |
| SMILES | C=C(NC)/C(N)=C\C(F)=C/C |
| InChI | InChI=1S/C8H13FN2/c1-4-7(9)5-8(10)6(2)11-3/h4-5,11H,2,10H2,1,3H3/b7-4+,8-5+ |
| InChIKey | NYSGIXHTNPPMTD-NSLJXJERSA-N |
| XLogP | 1.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|