C9H15FN2 — CID 134485832
1-(3-fluorobuta-1,3-dien-2-yl)piperidin-3-amine (PubChem CID 134485832) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is 1-(3-fluorobuta-1,3-dien-2-yl)piperidin-3-amine.
| Compound Name | 1-(3-fluorobuta-1,3-dien-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 134485832 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 1-(3-fluorobuta-1,3-dien-2-yl)piperidin-3-amine |
| SMILES | C=C(F)C(=C)N1CCCC(N)C1 |
| InChI | InChI=1S/C9H15FN2/c1-7(10)8(2)12-5-3-4-9(11)6-12/h9H,1-6,11H2 |
| InChIKey | XKZDIDWTLUUXEK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|