C12H20FN3 — CID 140764211
4-(4-ethylpiperazin-1-yl)-4-fluorocyclohexa-1,5-dien-1-amine (PubChem CID 140764211) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-4-fluorocyclohexa-1,5-dien-1-amine.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-4-fluorocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 140764211 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-4-fluorocyclohexa-1,5-dien-1-amine |
| SMILES | CCN1CCN(C2(F)C=CC(N)=CC2)CC1 |
| InChI | InChI=1S/C12H20FN3/c1-2-15-7-9-16(10-8-15)12(13)5-3-11(14)4-6-12/h3-5H,2,6-10,14H2,1H3 |
| InChIKey | HGEUUVFGAGRAFD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|