C46H38B3BrN3O2 — CID 123791182
CID 123791182 (PubChem CID 123791182) has the molecular formula C46H38B3BrN3O2 and a molecular weight of 777.17 g/mol.
| Compound Name | CID 123791182 |
|---|---|
| PubChem CID | 123791182 |
| Molecular Formula | C46H38B3BrN3O2 |
| Molecular Weight | 777.17 g/mol |
| Exact Mass | 776.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1cc([B])ccc1n2CC(O)CCc1ccc(C[B]c2ccc3c(c2)c2cc(Br)ccc2n3CC(O)Cn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C46H38B3BrN3O2/c47-32-10-15-43-38(21-32)39-22-33(48)11-16-44(39)52(43)27-36(54)14-9-29-5-7-30(8-6-29)25-49-34-12-17-45-40(23-34)41-24-35(50)13-18-46(41)53(45)28-37(55)26-51-20-19-31-3-1-2-4-42(31)51/h1-8,10-13,15-24,36-37,54-55H,9,14,25-28H2 |
| InChIKey | MNYWSEXXPIUSDE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 55.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.17 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|