About CID 123791182
CID 123791182 (PubChem CID 123791182) has the molecular formula C46H38B3BrN3O2
and a molecular weight of 777.17 g/mol.
Molecular Properties
| Compound Name | CID 123791182 |
| PubChem CID | 123791182 |
| Molecular Formula | C46H38B3BrN3O2 |
| Molecular Weight | 777.17 g/mol |
| Exact Mass | 776.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1cc([B])ccc1n2CC(O)CCc1ccc(C[B]c2ccc3c(c2)c2cc(Br)ccc2n3CC(O)Cn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C46H38B3BrN3O2/c47-32-10-15-43-38(21-32)39-22-33(48)11-16-44(39)52(43)27-36(54)14-9-29-5-7-30(8-6-29)25-49-34-12-17-45-40(23-34)41-24-35(50)13-18-46(41)53(45)28-37(55)26-51-20-19-31-3-1-2-4-42(31)51/h1-8,10-13,15-24,36-37,54-55H,9,14,25-28H2 |
| InChIKey | MNYWSEXXPIUSDE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 55.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 777.17 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123791182 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123791182?
The IUPAC name of CID 123791182 (CID 123791182) is not available.
What is the SMILES notation for CID 123791182?
The canonical SMILES for CID 123791182 is [B]c1ccc2c(c1)c1cc([B])ccc1n2CC(O)CCc1ccc(C[B]c2ccc3c(c2)c2cc(Br)ccc2n3CC(O)Cn2ccc3ccccc32)cc1.
What is the InChIKey of CID 123791182?
The InChIKey is MNYWSEXXPIUSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H38B3BrN3O2/c47-32-10-15-43-38(21-32)39-22-33(48)11-16-44(39)52(43)27-36(54)14-9-29-5-7-30(8-6-29)25-49-34-12-17-45-40(23-34)41-24-35(50)13-18-46(41)53(45)28-37(55)26-51-20-19-31-3-1-2-4-42(31)51/h1-8,10-13,15-24,36-37,54-55H,9,14,25-28H2.
What are the key properties of CID 123791182?
CID 123791182 has a molecular weight of 777.17 g/mol, XLogP of 6.79, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123791182 is sourced from PubChem (CID 123791182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).