C23H25F3N8O — CID 123791330
2-[5-[[6-(1-methylpyrazol-4-yl)-2-pyridinyl]methylamino]indazol-2-yl]-N-[2-(2,2,2-trifluoroethylamino)ethyl]acetamide (PubChem CID 123791330) has the molecular formula C23H25F3N8O and a molecular weight of 486.50 g/mol. Its IUPAC name is 2-[5-[[6-(1-methylpyrazol-4-yl)-2-pyridinyl]methylamino]indazol-2-yl]-N-[2-(2,2,2-trifluoroethylamino)ethyl]acetamide.
| Compound Name | 2-[5-[[6-(1-methylpyrazol-4-yl)-2-pyridinyl]methylamino]indazol-2-yl]-N-[2-(2,2,2-trifluoroethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 123791330 |
| Molecular Formula | C23H25F3N8O |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[5-[[6-(1-methylpyrazol-4-yl)-2-pyridinyl]methylamino]indazol-2-yl]-N-[2-(2,2,2-trifluoroethylamino)ethyl]acetamide |
| SMILES | Cn1cc(-c2cccc(CNc3ccc4nn(CC(=O)NCCNCC(F)(F)F)cc4c3)n2)cn1 |
| InChI | InChI=1S/C23H25F3N8O/c1-33-12-17(10-30-33)20-4-2-3-19(31-20)11-29-18-5-6-21-16(9-18)13-34(32-21)14-22(35)28-8-7-27-15-23(24,25)26/h2-6,9-10,12-13,27,29H,7-8,11,14-15H2,1H3,(H,28,35) |
| InChIKey | CYXKBOWMOCJAIE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|