About 2,3-di(ethylidene)thiophene 1-oxide
2,3-di(ethylidene)thiophene 1-oxide (PubChem CID 123792494) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 2,3-di(ethylidene)thiophene 1-oxide.
Molecular Properties
| Compound Name | 2,3-di(ethylidene)thiophene 1-oxide |
| PubChem CID | 123792494 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2,3-di(ethylidene)thiophene 1-oxide |
| SMILES | CC=C1C=CS(=O)C1=CC |
| InChI | InChI=1S/C8H10OS/c1-3-7-5-6-10(9)8(7)4-2/h3-6H,1-2H3 |
| InChIKey | KCHDVJJIZZIIOY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-di(ethylidene)thiophene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(ethylidene)thiophene 1-oxide?
The IUPAC name of 2,3-di(ethylidene)thiophene 1-oxide (CID 123792494) is 2,3-di(ethylidene)thiophene 1-oxide.
What is the SMILES notation for 2,3-di(ethylidene)thiophene 1-oxide?
The canonical SMILES for 2,3-di(ethylidene)thiophene 1-oxide is CC=C1C=CS(=O)C1=CC.
What is the InChIKey of 2,3-di(ethylidene)thiophene 1-oxide?
The InChIKey is KCHDVJJIZZIIOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-3-7-5-6-10(9)8(7)4-2/h3-6H,1-2H3.
What are the key properties of 2,3-di(ethylidene)thiophene 1-oxide?
2,3-di(ethylidene)thiophene 1-oxide has a molecular weight of 154.23 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(ethylidene)thiophene 1-oxide is sourced from PubChem (CID 123792494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).