2,3-di(ethylidene)thiophene 1-oxide

C8H10OS — CID 123792494

IUPAC2,3-di(ethylidene)thiophene 1-oxide
SMILESCC=C1C=CS(=O)C1=CC
InChIInChI=1S/C8H10OS/c1-3-7-5-6-10(9)8(7)4-2/h3-6H,1-2H3
InChIKeyKCHDVJJIZZIIOY-UHFFFAOYSA-N
MW154.23 g/mol
LogP2.11
Rot. Bonds

About 2,3-di(ethylidene)thiophene 1-oxide

2,3-di(ethylidene)thiophene 1-oxide (PubChem CID 123792494) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is 2,3-di(ethylidene)thiophene 1-oxide.

Molecular Properties

Compound Name2,3-di(ethylidene)thiophene 1-oxide
PubChem CID123792494
Molecular FormulaC8H10OS
Molecular Weight154.23 g/mol
Exact Mass154.05
IUPAC Name2,3-di(ethylidene)thiophene 1-oxide
SMILESCC=C1C=CS(=O)C1=CC
InChIInChI=1S/C8H10OS/c1-3-7-5-6-10(9)8(7)4-2/h3-6H,1-2H3
InChIKeyKCHDVJJIZZIIOY-UHFFFAOYSA-N
XLogP2.11
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.23
LogP ≤ 52.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze 2,3-di(ethylidene)thiophene 1-oxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-di(ethylidene)thiophene 1-oxide?
The IUPAC name of 2,3-di(ethylidene)thiophene 1-oxide (CID 123792494) is 2,3-di(ethylidene)thiophene 1-oxide.
What is the SMILES notation for 2,3-di(ethylidene)thiophene 1-oxide?
The canonical SMILES for 2,3-di(ethylidene)thiophene 1-oxide is CC=C1C=CS(=O)C1=CC.
What is the InChIKey of 2,3-di(ethylidene)thiophene 1-oxide?
The InChIKey is KCHDVJJIZZIIOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-3-7-5-6-10(9)8(7)4-2/h3-6H,1-2H3.
What are the key properties of 2,3-di(ethylidene)thiophene 1-oxide?
2,3-di(ethylidene)thiophene 1-oxide has a molecular weight of 154.23 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(ethylidene)thiophene 1-oxide is sourced from PubChem (CID 123792494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).