C16H30O6Si2 — CID 123794936
[1,1,2-trimethoxy-2-[4-(1,2,2-trimethoxy-2-silylethyl)phenyl]ethyl]silane (PubChem CID 123794936) has the molecular formula C16H30O6Si2 and a molecular weight of 374.58 g/mol. Its IUPAC name is [1,1,2-trimethoxy-2-[4-(1,2,2-trimethoxy-2-silylethyl)phenyl]ethyl]silane.
| Compound Name | [1,1,2-trimethoxy-2-[4-(1,2,2-trimethoxy-2-silylethyl)phenyl]ethyl]silane |
|---|---|
| PubChem CID | 123794936 |
| Molecular Formula | C16H30O6Si2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [1,1,2-trimethoxy-2-[4-(1,2,2-trimethoxy-2-silylethyl)phenyl]ethyl]silane |
| SMILES | COC(c1ccc(C(OC)C([SiH3])(OC)OC)cc1)C([SiH3])(OC)OC |
| InChI | InChI=1S/C16H30O6Si2/c1-17-13(15(23,19-3)20-4)11-7-9-12(10-8-11)14(18-2)16(24,21-5)22-6/h7-10,13-14H,1-6,23-24H3 |
| InChIKey | RAVTWIIKTKRLKU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|