C29H27N3O4S4 — CID 123795062
2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(3-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 123795062) has the molecular formula C29H27N3O4S4 and a molecular weight of 609.82 g/mol. Its IUPAC name is 2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(3-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(3-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 123795062 |
| Molecular Formula | C29H27N3O4S4 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | 2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(3-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1C(=O)C(=c2sc(=Cc3ccc4c(c3)C3CCCC3N4c3cccc(SC)c3)c(=O)n2CC(=O)O)SC1=S |
| InChI | InChI=1S/C29H27N3O4S4/c1-3-30-27(36)25(40-29(30)37)28-31(15-24(33)34)26(35)23(39-28)13-16-10-11-22-20(12-16)19-8-5-9-21(19)32(22)17-6-4-7-18(14-17)38-2/h4,6-7,10-14,19,21H,3,5,8-9,15H2,1-2H3,(H,33,34) |
| InChIKey | HOYCWBSMQTXQDM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|