C29H29N3O3S3 — CID 88893548
(2E,5E)-3-ethyl-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(4-methoxyphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 88893548) has the molecular formula C29H29N3O3S3 and a molecular weight of 563.77 g/mol. Its IUPAC name is (2E,5E)-3-ethyl-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(4-methoxyphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-ethyl-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(4-methoxyphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 88893548 |
| Molecular Formula | C29H29N3O3S3 |
| Molecular Weight | 563.77 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | (2E,5E)-3-ethyl-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[[4-(4-methoxyphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=c2\s/c(=C/c3ccc4c(c3)C3CCCC3N4c3ccc(OC)cc3)c(=O)n2CC)SC1=S |
| InChI | InChI=1S/C29H29N3O3S3/c1-4-30-26(33)24(37-28(30)25-27(34)31(5-2)29(36)38-25)16-17-9-14-23-21(15-17)20-7-6-8-22(20)32(23)18-10-12-19(35-3)13-11-18/h9-16,20,22H,4-8H2,1-3H3/b24-16+,28-25+ |
| InChIKey | UGRMRFUEUFUIMB-YRIBKUKBSA-N |
| XLogP | 4.54 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|