C29H25N3O4S3 — CID 76788086
[4-oxo-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-thiazolidin-3-yl]methyl formate (PubChem CID 76788086) has the molecular formula C29H25N3O4S3 and a molecular weight of 575.74 g/mol. Its IUPAC name is [4-oxo-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-thiazolidin-3-yl]methyl formate.
| Compound Name | [4-oxo-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-thiazolidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 76788086 |
| Molecular Formula | C29H25N3O4S3 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | [4-oxo-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-thiazolidin-3-yl]methyl formate |
| SMILES | C=CCN1C(=O)C(=c2sc(=Cc3ccc4c(c3)C3CCCC3N4c3ccccc3)c(=O)n2COC=O)SC1=S |
| InChI | InChI=1S/C29H25N3O4S3/c1-2-13-30-27(35)25(39-29(30)37)28-31(16-36-17-33)26(34)24(38-28)15-18-11-12-23-21(14-18)20-9-6-10-22(20)32(23)19-7-4-3-5-8-19/h2-5,7-8,11-12,14-15,17,20,22H,1,6,9-10,13,16H2 |
| InChIKey | DXLXDXQILAUDMH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|