About [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate
[methyl(3-methylbutan-2-yl)amino] N-formylcarbamate (PubChem CID 123795513) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate.
Molecular Properties
| Compound Name | [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate |
| PubChem CID | 123795513 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate |
| SMILES | CC(C)C(C)N(C)OC(=O)NC=O |
| InChI | InChI=1S/C8H16N2O3/c1-6(2)7(3)10(4)13-8(12)9-5-11/h5-7H,1-4H3,(H,9,11,12) |
| InChIKey | LSANDPVVXNTZJN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate?
The IUPAC name of [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate (CID 123795513) is [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate.
What is the SMILES notation for [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate?
The canonical SMILES for [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate is CC(C)C(C)N(C)OC(=O)NC=O.
What is the InChIKey of [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate?
The InChIKey is LSANDPVVXNTZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3/c1-6(2)7(3)10(4)13-8(12)9-5-11/h5-7H,1-4H3,(H,9,11,12).
What are the key properties of [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate?
[methyl(3-methylbutan-2-yl)amino] N-formylcarbamate has a molecular weight of 188.23 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(3-methylbutan-2-yl)amino] N-formylcarbamate is sourced from PubChem (CID 123795513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).