C8H18N2O3 — CID 171078131
ethane;N-formyl-3-hydroxy-2-(methylamino)butanamide (PubChem CID 171078131) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is ethane;N-formyl-3-hydroxy-2-(methylamino)butanamide.
| Compound Name | ethane;N-formyl-3-hydroxy-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 171078131 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | ethane;N-formyl-3-hydroxy-2-(methylamino)butanamide |
| SMILES | CC.CNC(C(=O)NC=O)C(C)O |
| InChI | InChI=1S/C6H12N2O3.C2H6/c1-4(10)5(7-2)6(11)8-3-9;1-2/h3-5,7,10H,1-2H3,(H,8,9,11);1-2H3 |
| InChIKey | BXOCMFDFVDOWLQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|